C22H17Cl2N3O3S — CID 135666041
(2Z)-5-[(2,5-dichlorophenyl)methyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135666041) has the molecular formula C22H17Cl2N3O3S and a molecular weight of 474.37 g/mol. Its IUPAC name is (2Z)-5-[(2,5-dichlorophenyl)methyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[(2,5-dichlorophenyl)methyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135666041 |
| Molecular Formula | C22H17Cl2N3O3S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | (2Z)-5-[(2,5-dichlorophenyl)methyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1C(Cc2cc(Cl)ccc2Cl)S/C(=N\N=C\c2ccccc2O)N1Cc1ccco1 |
| InChI | InChI=1S/C22H17Cl2N3O3S/c23-16-7-8-18(24)15(10-16)11-20-21(29)27(13-17-5-3-9-30-17)22(31-20)26-25-12-14-4-1-2-6-19(14)28/h1-10,12,20,28H,11,13H2/b25-12+,26-22- |
| InChIKey | JYGCNCZIOGAVQM-DMVPFBPMSA-N |
| XLogP | 5.37 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|