C27H28ClN3O4S — CID 3466817
2-[(4-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 3466817) has the molecular formula C27H28ClN3O4S and a molecular weight of 526.06 g/mol. Its IUPAC name is 2-[(4-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(4-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3466817 |
| Molecular Formula | C27H28ClN3O4S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 2-[(4-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccc(C=NN=C2SC(Cc3ccc(Cl)cc3)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C27H28ClN3O4S/c1-3-4-13-35-23-12-9-20(15-24(23)33-2)17-29-30-27-31(18-22-6-5-14-34-22)26(32)25(36-27)16-19-7-10-21(28)11-8-19/h5-12,14-15,17,25H,3-4,13,16,18H2,1-2H3 |
| InChIKey | MYOLMLGSBPXGGJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|