C32H27Cl2N3O6S — CID 16628139
(2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 16628139) has the molecular formula C32H27Cl2N3O6S and a molecular weight of 652.56 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628139 |
| Molecular Formula | C32H27Cl2N3O6S |
| Molecular Weight | 652.56 g/mol |
| Exact Mass | 651.10 |
| IUPAC Name | (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-5-[(3,4-dimethoxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\S/C(=N\N=C\c3ccc(OCc4ccc(Cl)cc4Cl)c(OC)c3)N(Cc3ccco3)C2=O)cc1OC |
| InChI | InChI=1S/C32H27Cl2N3O6S/c1-39-26-10-6-20(13-28(26)40-2)15-30-31(38)37(18-24-5-4-12-42-24)32(44-30)36-35-17-21-7-11-27(29(14-21)41-3)43-19-22-8-9-23(33)16-25(22)34/h4-17H,18-19H2,1-3H3/b30-15-,35-17+,36-32- |
| InChIKey | JRXDUFVYCJWAPK-BZLIKQLFSA-N |
| XLogP | 7.70 |
| TPSA | 95.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|