C30H22Cl2N4O6S — CID 16963389
(2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16963389) has the molecular formula C30H22Cl2N4O6S and a molecular weight of 637.50 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16963389 |
| Molecular Formula | C30H22Cl2N4O6S |
| Molecular Weight | 637.50 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | (2Z,5Z)-2-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N/N=C2\S/C(=C\c3ccc([N+](=O)[O-])cc3)C(=O)N2Cc2ccco2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H22Cl2N4O6S/c1-40-27-13-20(6-11-26(27)42-18-21-7-8-22(31)15-25(21)32)16-33-34-30-35(17-24-3-2-12-41-24)29(37)28(43-30)14-19-4-9-23(10-5-19)36(38)39/h2-16H,17-18H2,1H3/b28-14-,33-16+,34-30- |
| InChIKey | KUDFCAABZIAMHN-QUQZPSOTSA-N |
| XLogP | 7.59 |
| TPSA | 119.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.50 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|