C30H22Cl3N3O5S — CID 135732540
(2Z,5Z)-2-[(E)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135732540) has the molecular formula C30H22Cl3N3O5S and a molecular weight of 642.95 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135732540 |
| Molecular Formula | C30H22Cl3N3O5S |
| Molecular Weight | 642.95 g/mol |
| Exact Mass | 641.03 |
| IUPAC Name | (2Z,5Z)-2-[(E)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N\N=C\c3cc(Cl)ccc3O)N(Cc3ccco3)C2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H22Cl3N3O5S/c1-39-27-11-18(4-9-26(27)41-17-19-5-6-22(32)14-24(19)33)12-28-29(38)36(16-23-3-2-10-40-23)30(42-28)35-34-15-20-13-21(31)7-8-25(20)37/h2-15,37H,16-17H2,1H3/b28-12-,34-15+,35-30- |
| InChIKey | WIWJHOVAAXSOJH-NGPCXKKMSA-N |
| XLogP | 8.04 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.95 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|