C20H19BrFN3OS — CID 3733865
2-[(4-bromophenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-propyl-1,3-thiazolidin-4-one (PubChem CID 3733865) has the molecular formula C20H19BrFN3OS and a molecular weight of 448.36 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-propyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(4-bromophenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3733865 |
| Molecular Formula | C20H19BrFN3OS |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[(4-bromophenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCC1SC(=NN=Cc2ccc(Br)cc2)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H19BrFN3OS/c1-2-3-18-19(26)25(13-15-6-10-17(22)11-7-15)20(27-18)24-23-12-14-4-8-16(21)9-5-14/h4-12,18H,2-3,13H2,1H3 |
| InChIKey | FMMOZPPXADXNAA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|