C23H27FN4OS — CID 3834686
5-butyl-2-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 3834686) has the molecular formula C23H27FN4OS and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-butyl-2-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 5-butyl-2-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3834686 |
| Molecular Formula | C23H27FN4OS |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-butyl-2-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCC1SC(=NN=Cc2ccc(N(C)C)cc2)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C23H27FN4OS/c1-4-5-6-21-22(29)28(16-18-7-11-19(24)12-8-18)23(30-21)26-25-15-17-9-13-20(14-10-17)27(2)3/h7-15,21H,4-6,16H2,1-3H3 |
| InChIKey | PXVASMBNOOQXDT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|