C25H26FN3O3S — CID 118576920
benzyl N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]-N-(4-fluorophenyl)carbamimidothioate (PubChem CID 118576920) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is benzyl N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]-N-(4-fluorophenyl)carbamimidothioate.
| Compound Name | benzyl N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]-N-(4-fluorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 118576920 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | benzyl N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]-N-(4-fluorophenyl)carbamimidothioate |
| SMILES | COc1ccc(N(C)C(=O)C/N=C(/Nc2ccc(F)cc2)SCc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H26FN3O3S/c1-29(21-13-14-22(31-2)23(15-21)32-3)24(30)16-27-25(28-20-11-9-19(26)10-12-20)33-17-18-7-5-4-6-8-18/h4-15H,16-17H2,1-3H3,(H,27,28) |
| InChIKey | WYFIYYBDJFZWTM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|