C44H43F3N4O5S — CID 126673470
9H-fluoren-9-ylmethyl N-[(5S)-5-[[(2,6-difluorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]amino]-6-(3,4-dimethoxy-N-methylanilino)-6-oxohexyl]carbamate (PubChem CID 126673470) has the molecular formula C44H43F3N4O5S and a molecular weight of 796.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(5S)-5-[[(2,6-difluorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]amino]-6-(3,4-dimethoxy-N-methylanilino)-6-oxohexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(5S)-5-[[(2,6-difluorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]amino]-6-(3,4-dimethoxy-N-methylanilino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 126673470 |
| Molecular Formula | C44H43F3N4O5S |
| Molecular Weight | 796.91 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(5S)-5-[[(2,6-difluorophenyl)methylsulfanyl-(4-fluoroanilino)methylidene]amino]-6-(3,4-dimethoxy-N-methylanilino)-6-oxohexyl]carbamate |
| SMILES | COc1ccc(N(C)C(=O)[C@H](CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)/N=C(/Nc2ccc(F)cc2)SCc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C44H43F3N4O5S/c1-51(30-22-23-40(54-2)41(25-30)55-3)42(52)39(50-43(49-29-20-18-28(45)19-21-29)57-27-36-37(46)15-10-16-38(36)47)17-8-9-24-48-44(53)56-26-35-33-13-6-4-11-31(33)32-12-5-7-14-34(32)35/h4-7,10-16,18-23,25,35,39H,8-9,17,24,26-27H2,1-3H3,(H,48,53)(H,49,50)/t39-/m0/s1 |
| InChIKey | XXGSBNVZSIASJK-KDXMTYKHSA-N |
| XLogP | 9.56 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.91 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|