C27H28FN3O3 — CID 67477354
9H-fluoren-9-ylmethyl N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]carbamate (PubChem CID 67477354) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 67477354 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]carbamate |
| SMILES | Nc1cc(F)ccc1NC(=O)CCCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H28FN3O3/c28-18-13-14-25(24(29)16-18)31-26(32)12-2-1-7-15-30-27(33)34-17-23-21-10-5-3-8-19(21)20-9-4-6-11-22(20)23/h3-6,8-11,13-14,16,23H,1-2,7,12,15,17,29H2,(H,30,33)(H,31,32) |
| InChIKey | UQRSPPCUYJOAON-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|