C18H19F2N3O3S — CID 118577017
2-[(2,4-difluorophenyl)carbamothioylamino]-N-(3,4-dimethoxyphenyl)-N-methylacetamide (PubChem CID 118577017) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)carbamothioylamino]-N-(3,4-dimethoxyphenyl)-N-methylacetamide.
| Compound Name | 2-[(2,4-difluorophenyl)carbamothioylamino]-N-(3,4-dimethoxyphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 118577017 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[(2,4-difluorophenyl)carbamothioylamino]-N-(3,4-dimethoxyphenyl)-N-methylacetamide |
| SMILES | COc1ccc(N(C)C(=O)CNC(=S)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C18H19F2N3O3S/c1-23(12-5-7-15(25-2)16(9-12)26-3)17(24)10-21-18(27)22-14-6-4-11(19)8-13(14)20/h4-9H,10H2,1-3H3,(H2,21,22,27) |
| InChIKey | VBZGVXPXHVCTRI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|