C15H16N6O — CID 89220059
1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-phenylurea (PubChem CID 89220059) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 89220059 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-phenylurea |
| SMILES | NC(N)=N/N=C/c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N6O/c16-14(17)21-18-10-11-6-8-13(9-7-11)20-15(22)19-12-4-2-1-3-5-12/h1-10H,(H4,16,17,21)(H2,19,20,22)/b18-10+ |
| InChIKey | PNZQZTJCYVYLDX-VCHYOVAHSA-N |
| XLogP | 1.94 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|