C11H14N4O2 — CID 5474676
3-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl]propanoic acid (PubChem CID 5474676) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 5474676 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-[4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]phenyl]propanoic acid |
| SMILES | NC(N)=N/N=C\c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C11H14N4O2/c12-11(13)15-14-7-9-3-1-8(2-4-9)5-6-10(16)17/h1-4,7H,5-6H2,(H,16,17)(H4,12,13,15)/b14-7- |
| InChIKey | UDJWTXFRBLNMGP-AUWJEWJLSA-N |
| XLogP | 0.31 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|