C9H10N4O2 — CID 5356929
4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]benzoic acid (PubChem CID 5356929) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]benzoic acid.
| Compound Name | 4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 5356929 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-[(Z)-(diaminomethylidenehydrazinylidene)methyl]benzoic acid |
| SMILES | NC(N)=N/N=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H10N4O2/c10-9(11)13-12-5-6-1-3-7(4-2-6)8(14)15/h1-5H,(H,14,15)(H4,10,11,13)/b12-5- |
| InChIKey | RAQABEGPTYMRTN-XGICHPGQSA-N |
| XLogP | -0.01 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|