C8H11BrN4 — CID 75485430
2-[(E)-benzylideneamino]guanidine;hydrobromide (PubChem CID 75485430) has the molecular formula C8H11BrN4 and a molecular weight of 243.11 g/mol. Its IUPAC name is 2-[(E)-benzylideneamino]guanidine;hydrobromide.
| Compound Name | 2-[(E)-benzylideneamino]guanidine;hydrobromide |
|---|---|
| PubChem CID | 75485430 |
| Molecular Formula | C8H11BrN4 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-[(E)-benzylideneamino]guanidine;hydrobromide |
| SMILES | Br.NC(N)=N/N=C/c1ccccc1 |
| InChI | InChI=1S/C8H10N4.BrH/c9-8(10)12-11-6-7-4-2-1-3-5-7;/h1-6H,(H4,9,10,12);1H/b11-6+; |
| InChIKey | RMCLIUDVKGWIPU-ICSBZGNSSA-N |
| XLogP | 0.87 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|