C16H18N8 — CID 134136656
2-[(E)-[3-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]phenyl]methylideneamino]guanidine (PubChem CID 134136656) has the molecular formula C16H18N8 and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-[(E)-[3-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[3-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 134136656 |
| Molecular Formula | C16H18N8 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-[(E)-[3-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(-c2cccc(/C=N/N=C(N)N)c2)cc1 |
| InChI | InChI=1S/C16H18N8/c17-15(18)23-21-9-11-4-6-13(7-5-11)14-3-1-2-12(8-14)10-22-24-16(19)20/h1-10H,(H4,17,18,23)(H4,19,20,24)/b21-9+,22-10+ |
| InChIKey | ASAFZZGZCWCAQQ-VGENTYGXSA-N |
| XLogP | 0.57 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|