C9H10ClF3N4 — CID 86278990
2-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride (PubChem CID 86278990) has the molecular formula C9H10ClF3N4 and a molecular weight of 266.65 g/mol. Its IUPAC name is 2-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 86278990 |
| Molecular Formula | C9H10ClF3N4 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/N=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3N4.ClH/c10-9(11,12)7-3-1-2-6(4-7)5-15-16-8(13)14;/h1-5H,(H4,13,14,16);1H/b15-5+; |
| InChIKey | QNHBCGNFUAYHHS-GBDQXREISA-N |
| XLogP | 1.73 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|