C10H12F2N4 — CID 168591146
2-[[4-(1,1-difluoroethyl)phenyl]methylideneamino]guanidine (PubChem CID 168591146) has the molecular formula C10H12F2N4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[[4-(1,1-difluoroethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(1,1-difluoroethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591146 |
| Molecular Formula | C10H12F2N4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[[4-(1,1-difluoroethyl)phenyl]methylideneamino]guanidine |
| SMILES | CC(F)(F)c1ccc(C=NN=C(N)N)cc1 |
| InChI | InChI=1S/C10H12F2N4/c1-10(11,12)8-4-2-7(3-5-8)6-15-16-9(13)14/h2-6H,1H3,(H4,13,14,16) |
| InChIKey | GUDIIHVAYJZWLV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|