C10H9F3N2O — CID 5341237
N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 5341237) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5341237 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | CC(=O)N/N=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O/c1-7(16)15-14-6-8-3-2-4-9(5-8)10(11,12)13/h2-6H,1H3,(H,15,16)/b14-6+ |
| InChIKey | ZDDAQOZVBAUEDW-MKMNVTDBSA-N |
| XLogP | 2.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|