C17H12F4I2N4O — CID 148980870
1-[(Z)-[3-[fluoro(diiodo)methyl]phenyl]methylideneamino]-3-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]urea (PubChem CID 148980870) has the molecular formula C17H12F4I2N4O and a molecular weight of 618.11 g/mol. Its IUPAC name is 1-[(Z)-[3-[fluoro(diiodo)methyl]phenyl]methylideneamino]-3-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]urea.
| Compound Name | 1-[(Z)-[3-[fluoro(diiodo)methyl]phenyl]methylideneamino]-3-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 148980870 |
| Molecular Formula | C17H12F4I2N4O |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 617.90 |
| IUPAC Name | 1-[(Z)-[3-[fluoro(diiodo)methyl]phenyl]methylideneamino]-3-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]urea |
| SMILES | O=C(N/N=C\c1cccc(C(F)(F)F)c1)N/N=C\c1cccc(C(F)(I)I)c1 |
| InChI | InChI=1S/C17H12F4I2N4O/c18-16(19,20)13-5-1-3-11(7-13)9-24-26-15(28)27-25-10-12-4-2-6-14(8-12)17(21,22)23/h1-10H,(H2,26,27,28)/b24-9-,25-10- |
| InChIKey | PVSBPFHGWWHMAC-QNSJPTDDSA-N |
| XLogP | 5.32 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|