C10H11F3N4O — CID 168592270
2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168592270) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592270 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N4O/c11-10(12,13)6-18-8-3-1-2-7(4-8)5-16-17-9(14)15/h1-5H,6H2,(H4,14,15,17) |
| InChIKey | QRRLRORPPYWVKG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|