C24H25Cl3F2N12 — CID 172956767
2-[(E)-benzylideneamino]guanidine;2-[(E)-(2-chloro-4,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3,5-dichlorophenyl)methylideneamino]guanidine (PubChem CID 172956767) has the molecular formula C24H25Cl3F2N12 and a molecular weight of 625.90 g/mol. Its IUPAC name is 2-[(E)-benzylideneamino]guanidine;2-[(E)-(2-chloro-4,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3,5-dichlorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-benzylideneamino]guanidine;2-[(E)-(2-chloro-4,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3,5-dichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 172956767 |
| Molecular Formula | C24H25Cl3F2N12 |
| Molecular Weight | 625.90 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 2-[(E)-benzylideneamino]guanidine;2-[(E)-(2-chloro-4,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3,5-dichlorophenyl)methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1cc(Cl)cc(Cl)c1.NC(N)=N/N=C/c1cc(F)c(F)cc1Cl.NC(N)=N/N=C/c1ccccc1 |
| InChI | InChI=1S/C8H8Cl2N4.C8H7ClF2N4.C8H10N4/c9-6-1-5(2-7(10)3-6)4-13-14-8(11)12;9-5-2-7(11)6(10)1-4(5)3-14-15-8(12)13;9-8(10)12-11-6-7-4-2-1-3-5-7/h1-4H,(H4,11,12,14);1-3H,(H4,12,13,15);1-6H,(H4,9,10,12)/b13-4+;14-3+;11-6+ |
| InChIKey | IUZVOPOHBQGGNK-HCPNUPLASA-N |
| XLogP | 3.12 |
| TPSA | 230.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|