C8H11Cl2N5 — CID 171369925
2-[(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 171369925) has the molecular formula C8H11Cl2N5 and a molecular weight of 248.12 g/mol. Its IUPAC name is 2-[(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 171369925 |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-[(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NN=Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C8H10ClN5.ClH/c9-7-3-6(10)2-1-5(7)4-13-14-8(11)12;/h1-4H,10H2,(H4,11,12,14);1H |
| InChIKey | WDCXQCKQQMBXFW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|