C8H8Cl2N4 — CID 66842284
2-[(3,5-dichlorophenyl)methylideneamino]guanidine (PubChem CID 66842284) has the molecular formula C8H8Cl2N4 and a molecular weight of 231.09 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3,5-dichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 66842284 |
| Molecular Formula | C8H8Cl2N4 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N4/c9-6-1-5(2-7(10)3-6)4-13-14-8(11)12/h1-4H,(H4,11,12,14) |
| InChIKey | DYTPLPXEJHIPJS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|