C10H10Cl2N4O2 — CID 91464433
[[N'-[(3,5-dichlorophenyl)methylideneamino]carbamimidoyl]amino] acetate (PubChem CID 91464433) has the molecular formula C10H10Cl2N4O2 and a molecular weight of 289.12 g/mol. Its IUPAC name is [[N'-[(3,5-dichlorophenyl)methylideneamino]carbamimidoyl]amino] acetate.
| Compound Name | [[N'-[(3,5-dichlorophenyl)methylideneamino]carbamimidoyl]amino] acetate |
|---|---|
| PubChem CID | 91464433 |
| Molecular Formula | C10H10Cl2N4O2 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | [[N'-[(3,5-dichlorophenyl)methylideneamino]carbamimidoyl]amino] acetate |
| SMILES | CC(=O)ONC(N)=NN=Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N4O2/c1-6(17)18-16-10(13)15-14-5-7-2-8(11)4-9(12)3-7/h2-5H,1H3,(H3,13,15,16) |
| InChIKey | KZHMIIMOCPJIKM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|