C13H12N4O3 — CID 6115254
4-[5-[(Z)-(diaminomethylidenehydrazinylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 6115254) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[5-[(Z)-(diaminomethylidenehydrazinylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(Z)-(diaminomethylidenehydrazinylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6115254 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-[5-[(Z)-(diaminomethylidenehydrazinylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | NC(N)=N/N=C\c1ccc(-c2ccc(C(=O)O)cc2)o1 |
| InChI | InChI=1S/C13H12N4O3/c14-13(15)17-16-7-10-5-6-11(20-10)8-1-3-9(4-2-8)12(18)19/h1-7H,(H,18,19)(H4,14,15,17)/b16-7- |
| InChIKey | KWVCUZMSGMUFDE-APSNUPSMSA-N |
| XLogP | 1.25 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|