C19H21F2N3S — CID 43811289
(3,4-difluorophenyl)methyl N'-[(E)-[4-(2-methylpropyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 43811289) has the molecular formula C19H21F2N3S and a molecular weight of 361.46 g/mol. Its IUPAC name is (3,4-difluorophenyl)methyl N'-[(E)-[4-(2-methylpropyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | (3,4-difluorophenyl)methyl N'-[(E)-[4-(2-methylpropyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 43811289 |
| Molecular Formula | C19H21F2N3S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (3,4-difluorophenyl)methyl N'-[(E)-[4-(2-methylpropyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | CC(C)Cc1ccc(/C=N/N=C(\N)SCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H21F2N3S/c1-13(2)9-14-3-5-15(6-4-14)11-23-24-19(22)25-12-16-7-8-17(20)18(21)10-16/h3-8,10-11,13H,9,12H2,1-2H3,(H2,22,24)/b23-11+ |
| InChIKey | APJFLNBIVCLRMH-FOKLQQMPSA-N |
| XLogP | 4.75 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|