C22H18ClF2N3OS — CID 168611611
benzyl N'-[[5-chloro-2-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168611611) has the molecular formula C22H18ClF2N3OS and a molecular weight of 445.92 g/mol. Its IUPAC name is benzyl N'-[[5-chloro-2-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[5-chloro-2-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611611 |
| Molecular Formula | C22H18ClF2N3OS |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | benzyl N'-[[5-chloro-2-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Cl)ccc1OCc1ccc(F)c(F)c1)SCc1ccccc1 |
| InChI | InChI=1S/C22H18ClF2N3OS/c23-18-7-9-21(29-13-16-6-8-19(24)20(25)10-16)17(11-18)12-27-28-22(26)30-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H2,26,28) |
| InChIKey | TZMKJQGMQRLLSN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|