C22H19ClFN3OS — CID 168612266
benzyl N'-[[5-chloro-2-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612266) has the molecular formula C22H19ClFN3OS and a molecular weight of 427.93 g/mol. Its IUPAC name is benzyl N'-[[5-chloro-2-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[5-chloro-2-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612266 |
| Molecular Formula | C22H19ClFN3OS |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | benzyl N'-[[5-chloro-2-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Cl)ccc1OCc1cccc(F)c1)SCc1ccccc1 |
| InChI | InChI=1S/C22H19ClFN3OS/c23-19-9-10-21(28-14-17-7-4-8-20(24)11-17)18(12-19)13-26-27-22(25)29-15-16-5-2-1-3-6-16/h1-13H,14-15H2,(H2,25,27) |
| InChIKey | XTHDMAGWJKTTDU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|