C22H18FN3O2S — CID 168612193
4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]-3-fluorobenzoic acid (PubChem CID 168612193) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 168612193 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]-3-fluorobenzoic acid |
| SMILES | NC(=NN=Cc1ccc(-c2ccc(C(=O)O)cc2F)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H18FN3O2S/c23-20-12-18(21(27)28)10-11-19(20)17-8-6-15(7-9-17)13-25-26-22(24)29-14-16-4-2-1-3-5-16/h1-13H,14H2,(H2,24,26)(H,27,28) |
| InChIKey | PYXVFFRLOFJAPZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|