C25H25N3O2S — CID 168611811
propan-2-yl 4-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]benzoate (PubChem CID 168611811) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is propan-2-yl 4-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]benzoate.
| Compound Name | propan-2-yl 4-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 168611811 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | propan-2-yl 4-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]phenyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(-c2ccccc2C=NN=C(N)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-18(2)30-24(29)21-14-12-20(13-15-21)23-11-7-6-10-22(23)16-27-28-25(26)31-17-19-8-4-3-5-9-19/h3-16,18H,17H2,1-2H3,(H2,26,28) |
| InChIKey | CHKGYFKTHUEPNU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|