C16H14F3N3O2S2 — CID 168613351
benzyl N'-[[3-(trifluoromethylsulfonyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613351) has the molecular formula C16H14F3N3O2S2 and a molecular weight of 401.44 g/mol. Its IUPAC name is benzyl N'-[[3-(trifluoromethylsulfonyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-(trifluoromethylsulfonyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613351 |
| Molecular Formula | C16H14F3N3O2S2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | benzyl N'-[[3-(trifluoromethylsulfonyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cccc(S(=O)(=O)C(F)(F)F)c1)SCc1ccccc1 |
| InChI | InChI=1S/C16H14F3N3O2S2/c17-16(18,19)26(23,24)14-8-4-7-13(9-14)10-21-22-15(20)25-11-12-5-2-1-3-6-12/h1-10H,11H2,(H2,20,22) |
| InChIKey | NNSCXWJPGWDGMY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|