C20H18N4OS — CID 168612171
benzyl N'-[(3-pyridin-2-yloxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168612171) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is benzyl N'-[(3-pyridin-2-yloxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3-pyridin-2-yloxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612171 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | benzyl N'-[(3-pyridin-2-yloxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cccc(Oc2ccccn2)c1)SCc1ccccc1 |
| InChI | InChI=1S/C20H18N4OS/c21-20(26-15-16-7-2-1-3-8-16)24-23-14-17-9-6-10-18(13-17)25-19-11-4-5-12-22-19/h1-14H,15H2,(H2,21,24) |
| InChIKey | BIQBFKRYLZSFET-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|