C17H15N5OS — CID 168612231
benzyl N'-[[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612231) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is benzyl N'-[[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612231 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | benzyl N'-[[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cccc(-c2ncon2)c1)SCc1ccccc1 |
| InChI | InChI=1S/C17H15N5OS/c18-17(24-11-13-5-2-1-3-6-13)21-20-10-14-7-4-8-15(9-14)16-19-12-23-22-16/h1-10,12H,11H2,(H2,18,21) |
| InChIKey | VGRMKUDJJVZBTC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|