About benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate
benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612229) has the molecular formula C18H17N5OS
and a molecular weight of 351.44 g/mol. Its IUPAC name is benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate |
| PubChem CID | 168612229 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | Cc1nc(-c2cccc(C=NN=C(N)SCc3ccccc3)c2)no1 |
| InChI | InChI=1S/C18H17N5OS/c1-13-21-17(23-24-13)16-9-5-8-15(10-16)11-20-22-18(19)25-12-14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H2,19,22) |
| InChIKey | MERUUTBYYWLLDL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate?
The IUPAC name of benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate (CID 168612229) is benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate.
What is the SMILES notation for benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate?
The canonical SMILES for benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate is Cc1nc(-c2cccc(C=NN=C(N)SCc3ccccc3)c2)no1.
What is the InChIKey of benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate?
The InChIKey is MERUUTBYYWLLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5OS/c1-13-21-17(23-24-13)16-9-5-8-15(10-16)11-20-22-18(19)25-12-14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H2,19,22).
What are the key properties of benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate?
benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate has a molecular weight of 351.44 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N'-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]carbamimidothioate is sourced from PubChem (CID 168612229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).