C10H8N2O2 — CID 7060547
3-(5-methyl-1,2,4-oxadiazol-3-yl)benzaldehyde (PubChem CID 7060547) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzaldehyde.
| Compound Name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 7060547 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzaldehyde |
| SMILES | Cc1nc(-c2cccc(C=O)c2)no1 |
| InChI | InChI=1S/C10H8N2O2/c1-7-11-10(12-14-7)9-4-2-3-8(5-9)6-13/h2-6H,1H3 |
| InChIKey | UEKHVFDHZRFETL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|