C22H23FN6O2S — CID 168612725
benzyl N'-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612725) has the molecular formula C22H23FN6O2S and a molecular weight of 454.53 g/mol. Its IUPAC name is benzyl N'-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612725 |
| Molecular Formula | C22H23FN6O2S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | benzyl N'-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(F)c(-c2noc(CN3CCOCC3)n2)c1)SCc1ccccc1 |
| InChI | InChI=1S/C22H23FN6O2S/c23-19-7-6-17(13-25-27-22(24)32-15-16-4-2-1-3-5-16)12-18(19)21-26-20(31-28-21)14-29-8-10-30-11-9-29/h1-7,12-13H,8-11,14-15H2,(H2,24,27) |
| InChIKey | YYDWXCNTJZNDKS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|