C22H28N4OS — CID 168612049
benzyl N'-[[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612049) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is benzyl N'-[[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612049 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | benzyl N'-[[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(C=NN=C(N)SCc2ccccc2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C22H28N4OS/c1-27-21-11-10-19(14-20(21)16-26-12-6-3-7-13-26)15-24-25-22(23)28-17-18-8-4-2-5-9-18/h2,4-5,8-11,14-15H,3,6-7,12-13,16-17H2,1H3,(H2,23,25) |
| InChIKey | FSWXGWBRQDKVST-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|