C23H22BrN3O2S — CID 168611953
benzyl N'-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 168611953) has the molecular formula C23H22BrN3O2S and a molecular weight of 484.42 g/mol. Its IUPAC name is benzyl N'-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611953 |
| Molecular Formula | C23H22BrN3O2S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | benzyl N'-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(C=NN=C(N)SCc2ccccc2)cc1COc1ccccc1Br |
| InChI | InChI=1S/C23H22BrN3O2S/c1-28-21-12-11-18(13-19(21)15-29-22-10-6-5-9-20(22)24)14-26-27-23(25)30-16-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3,(H2,25,27) |
| InChIKey | LHNKGAQPNJVEAM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|