C18H16BrN3OS — CID 168612390
benzyl N'-[(3-bromo-4-prop-2-ynoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168612390) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is benzyl N'-[(3-bromo-4-prop-2-ynoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3-bromo-4-prop-2-ynoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612390 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | benzyl N'-[(3-bromo-4-prop-2-ynoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | C#CCOc1ccc(C=NN=C(N)SCc2ccccc2)cc1Br |
| InChI | InChI=1S/C18H16BrN3OS/c1-2-10-23-17-9-8-15(11-16(17)19)12-21-22-18(20)24-13-14-6-4-3-5-7-14/h1,3-9,11-12H,10,13H2,(H2,20,22) |
| InChIKey | JLLZZIIWVXVSTD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|