C26H24N4O2S — CID 168612770
benzyl N'-[[4-methoxy-3-(quinolin-7-yloxymethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612770) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is benzyl N'-[[4-methoxy-3-(quinolin-7-yloxymethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-methoxy-3-(quinolin-7-yloxymethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612770 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | benzyl N'-[[4-methoxy-3-(quinolin-7-yloxymethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(C=NN=C(N)SCc2ccccc2)cc1COc1ccc2cccnc2c1 |
| InChI | InChI=1S/C26H24N4O2S/c1-31-25-12-9-20(16-29-30-26(27)33-18-19-6-3-2-4-7-19)14-22(25)17-32-23-11-10-21-8-5-13-28-24(21)15-23/h2-16H,17-18H2,1H3,(H2,27,30) |
| InChIKey | XIVXALFLYBWYSW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|