C20H24N4S — CID 168613535
benzyl N'-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613535) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is benzyl N'-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613535 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | benzyl N'-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cccc(CN2CCCC2)c1)SCc1ccccc1 |
| InChI | InChI=1S/C20H24N4S/c21-20(25-16-17-7-2-1-3-8-17)23-22-14-18-9-6-10-19(13-18)15-24-11-4-5-12-24/h1-3,6-10,13-14H,4-5,11-12,15-16H2,(H2,21,23) |
| InChIKey | QBWZHDSDDZDVSN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|