C13H19N5O — CID 168590992
2-[[3-(morpholin-4-ylmethyl)phenyl]methylideneamino]guanidine (PubChem CID 168590992) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-[[3-(morpholin-4-ylmethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-(morpholin-4-ylmethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590992 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-[[3-(morpholin-4-ylmethyl)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C13H19N5O/c14-13(15)17-16-9-11-2-1-3-12(8-11)10-18-4-6-19-7-5-18/h1-3,8-9H,4-7,10H2,(H4,14,15,17) |
| InChIKey | RVNRXZGOAWIOHB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|