C26H40N4O4 — CID 15495103
3-[[16-[(3-aminophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]aniline (PubChem CID 15495103) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[[16-[(3-aminophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]aniline.
| Compound Name | 3-[[16-[(3-aminophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]aniline |
|---|---|
| PubChem CID | 15495103 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 3-[[16-[(3-aminophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]aniline |
| SMILES | Nc1cccc(CN2CCOCCOCCN(Cc3cccc(N)c3)CCOCCOCC2)c1 |
| InChI | InChI=1S/C26H40N4O4/c27-25-5-1-3-23(19-25)21-29-7-11-31-15-17-33-13-9-30(10-14-34-18-16-32-12-8-29)22-24-4-2-6-26(28)20-24/h1-6,19-20H,7-18,21-22,27-28H2 |
| InChIKey | IYIOLGYROHDHPW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|