C13H20N2O — CID 58543772
N,N-dimethyl-3-(morpholin-4-ylmethyl)aniline (PubChem CID 58543772) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N,N-dimethyl-3-(morpholin-4-ylmethyl)aniline.
| Compound Name | N,N-dimethyl-3-(morpholin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 58543772 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N,N-dimethyl-3-(morpholin-4-ylmethyl)aniline |
| SMILES | CN(C)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C13H20N2O/c1-14(2)13-5-3-4-12(10-13)11-15-6-8-16-9-7-15/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | WHVRIVOXKJDVTI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |