C19H25N3 — CID 110454866
3-(4-benzylpiperazin-1-yl)-N,N-dimethylaniline (PubChem CID 110454866) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-N,N-dimethylaniline.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 110454866 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H25N3/c1-20(2)18-9-6-10-19(15-18)22-13-11-21(12-14-22)16-17-7-4-3-5-8-17/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | NCDHNLNXORBEMW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |