C23H37N3O — CID 95894428
4-[[3-[[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]methyl]phenyl]methyl]morpholine (PubChem CID 95894428) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 4-[[3-[[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]methyl]phenyl]methyl]morpholine.
| Compound Name | 4-[[3-[[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]methyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 95894428 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 4-[[3-[[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]methyl]phenyl]methyl]morpholine |
| SMILES | C[C@H](C1CCN(Cc2cccc(CN3CCOCC3)c2)CC1)N1CCCC1 |
| InChI | InChI=1S/C23H37N3O/c1-20(26-9-2-3-10-26)23-7-11-24(12-8-23)18-21-5-4-6-22(17-21)19-25-13-15-27-16-14-25/h4-6,17,20,23H,2-3,7-16,18-19H2,1H3/t20-/m1/s1 |
| InChIKey | QETQHUMIYRFDFT-HXUWFJFHSA-N |
| XLogP | 3.22 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |