C18H26ClFN2O — CID 70705816
4-[1-[1-[(4-chloro-3-fluorophenyl)methyl]piperidin-4-yl]ethyl]morpholine (PubChem CID 70705816) has the molecular formula C18H26ClFN2O and a molecular weight of 340.87 g/mol. Its IUPAC name is 4-[1-[1-[(4-chloro-3-fluorophenyl)methyl]piperidin-4-yl]ethyl]morpholine.
| Compound Name | 4-[1-[1-[(4-chloro-3-fluorophenyl)methyl]piperidin-4-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 70705816 |
| Molecular Formula | C18H26ClFN2O |
| Molecular Weight | 340.87 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[1-[1-[(4-chloro-3-fluorophenyl)methyl]piperidin-4-yl]ethyl]morpholine |
| SMILES | CC(C1CCN(Cc2ccc(Cl)c(F)c2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C18H26ClFN2O/c1-14(22-8-10-23-11-9-22)16-4-6-21(7-5-16)13-15-2-3-17(19)18(20)12-15/h2-3,12,14,16H,4-11,13H2,1H3 |
| InChIKey | PGAJNTXFQBNCRJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |