C21H34N2O2 — CID 70784455
4-[1-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-4-yl]ethyl]morpholine (PubChem CID 70784455) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 4-[1-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-4-yl]ethyl]morpholine.
| Compound Name | 4-[1-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-4-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 70784455 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 4-[1-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-4-yl]ethyl]morpholine |
| SMILES | CC(C)Oc1cccc(CN2CCC(C(C)N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C21H34N2O2/c1-17(2)25-21-6-4-5-19(15-21)16-22-9-7-20(8-10-22)18(3)23-11-13-24-14-12-23/h4-6,15,17-18,20H,7-14,16H2,1-3H3 |
| InChIKey | NAFVYOFYIXSUNS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |