C16H25ClN2O — CID 120660913
(3aR,6aS)-5-[(3-propan-2-yloxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660913) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is (3aR,6aS)-5-[(3-propan-2-yloxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(3-propan-2-yloxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660913 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3aR,6aS)-5-[(3-propan-2-yloxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | CC(C)Oc1cccc(CN2C[C@H]3CNC[C@H]3C2)c1.Cl |
| InChI | InChI=1S/C16H24N2O.ClH/c1-12(2)19-16-5-3-4-13(6-16)9-18-10-14-7-17-8-15(14)11-18;/h3-6,12,14-15,17H,7-11H2,1-2H3;1H/t14-,15+; |
| InChIKey | ODVCFWDONDENJG-KBGJBQQCSA-N |
| XLogP | 2.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |